What is the Iupac name of Benzil?
What is the Iupac name of Benzil?
| IUPAC Name | 1,2-diphenylethane-1,2-dione |
|---|---|
| Molar Mass | 210.232 g/mol |
| InChI | InChI=1S/C14H10O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H |
| InChI Key | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| CAS Number 134-81-6 |
Which method is useful for preparation of imidazoles?
The condensation of the corresponding abromoketones with formamidine acetate in liquid ammonia was revealed to be a useful method for the synthesis of such imidazole derivatives (35), derivatives thus prepared are structurally related to histamine.
What is the chemical formula of imidazole?
C3H4N2
Imidazole/Formula
Which drugs are imidazole?
Many imidazole-based derivatives have been marketed as antifungal drugs such as ketoconazole (1), miconazole (2), clotrimazole (3), tioconazole (4), econazole (5), tinidazole (6), enilconazole/imazalil (7), parconazole (8), eberconazole (9), lanoconazole (10), fenticonazole (11), bifonazole (12), sulconazole (13).
What is the structure of Benzil?
Benzil
| PubChem CID | 8651 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C14H10O2 |
| Synonyms | BENZIL 134-81-6 Diphenylethanedione Dibenzoyl Diphenylglyoxal More… |
Why is imidazole Basic?
Imidazole is more basic than pyridine. This is due to the greater resonance stabilization of the positive charge of its conjugate acid. Greater the pka value, the more basic the species become. Originally Answered: How can you explain imidazole being more basic than pyridine?
Why is imidazole amphoteric?
Imidazole is amphoteric; that is, it can function as both an acid and a base. The compound is classified as aromatic due to the presence of a sextet of π-electrons, consisting of a pair of electrons from the protonated nitrogen atom and one from each of the remaining four atoms of the ring.
What is synthesis of imidazole?
Synthesis of imidazoles. In a gold-catalyzed synthesis of bicyclic imidazoles, a highly electrophilic α-imino gold carbene intermediate can react with a weakly nucleophilic nitrile, which is used as the reaction solvent, to deliver the desired product rapidly in an overall bimolecular [2 + 2 + 1] cycloaddition and in good yield.
Where are imidazoles used today?
Since then, this particular heterocyclic family has hugely expanded and imidazoles are found today in a myriad o f applications. They play an important 2002). Imidazole c an also be found in various compounds which are used for elements (Hartmann et al., 2010).
What is the difference between the imidazole and the triazole?
The difference between the imidazoles and the triazoles involves the mechanism of inhibition of the cytochrome P450 enzyme. The N3 of the imidazole compound binds to the heme iron atom of ferric cytochrome P450, whereas the N4 of the triazoles bind to the heme group.
What is the role of imidazole in amphoterism?
Amphoterism. Imidazole is used to elute tagged proteins bound to nickel ions attached to the surface of beads in the chromatography column. An excess of imidazole is passed through the column, which displaces the His-tag from nickel coordination, freeing the His-tagged proteins.
