What is the melting point of lidocaine?
What is the melting point of lidocaine?
154.4°F (68°C)
Lidocaine/Melting point
What does lidocaine dissolve in?
Lidocaine (lignocaine, C14H22N2O, MW 234.34) occurs as a white to slightly yellow, crystalline powder with a characteristic odor. It has a melting range of 66°C to 69°C. Lidocaine is practically insoluble in water and very soluble in alcohol; it dissolves in oils.
How do you crystalize lidocaine?
Lidocaine is highly soluble in all common organic solvents but it can be recrystallized from warm hexane using 1 mL of solvent per gram of crude product. The product crystallizes in large colorless spars, mp 65–67 °C (lit. 67–69 °C).
Is lidocaine polar or non polar?
At that pH, there are two species of lidocaine molecules: one is the charged or polar molecule, and the other is the uncharged or nonpolar molecule. There is a predominance of the charged molecule: about 10 times as much charged/polar lidocaine ion as uncharged/nonpolar lidocaine.
Is lidocaine hydrophilic or hydrophobic?
As a tertiary amine, lidocaine can be hydrophilic when it is protonated and can be hydrophobic when it is in its neutral form.
What is the empirical formula for lidocaine?
Identification of Lidocaine Chemical Compound
| Chemical Formula | C14H22N2O |
|---|---|
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide |
| SMILES String | CCN(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) |
| InChIKey | NNJVILVZKWQKPM-UHFFFAOYSA-N |
Is lidocaine used in dentistry?
Nowadays, the most common anesthetic dentists use is Lidocaine. Novocain used to be the more common option a few decades ago, professionals now use other anesthetics that work better and longer.
How is lidocaine metabolized?
Lidocaine is metabolized in the liver by the P450 3A4 isoenzyme, a member of the subfamily of P450 isoenzymes. This isoenzyme, the most abundant of the human P450 enzymes, is responsible for the metabolism of more drugs than any other hepatic enzyme.
What is the empirical formula of lidocaine?
C14H22N2O
Lidocaine/Formula
What is the pH of lidocaine?
Plain 1% lidocaine had a pH of 6.09±0.16, and plain 2% lidocaine had a pH of 6.00±0.27.
Is lidocaine HCL water soluble?
Solubility : Soluble in water (50 mg/ml), chloroform, ethanol, and benzene. Insoluble in diethyl ether.
What is the molecular formula for lidocaine?
Lidocaine PubChem CID 3676 Structure Find Similar Structures Chemical Safety Laboratory Chemical Safety Summary (LCSS Molecular Formula C14H22N2O Synonyms lidocaine 137-58-6 Lignocaine Xylocaine
How does lidocaine work?
More… Lidocaine is a synthetic aminoethylamide with local anesthetic and antiarrhythmic properties. Lidocaine stabilizes the neuronal membrane by binding to and inhibiting voltage-gated sodium channels, thereby inhibiting the ionic fluxes required for the initiation and conduction of impulses and effecting local anesthesia.
What is the CID number for lidocaine hydrochloride?
Lidocaine hydrochloride PubChem CID 6314 Parent Compound CID 3676 (Lidocaine) Component Compounds CID 3676 (Lidocaine) CID 313 (Hydrochlor Date s Modify 2021-08-28 Create 2005-06-24
What is the difference between propionate and lidocaine?
Lidocaine is a local anesthetic and cardiac depressant used as an antiarrhythmia agent. Its actions are more intense and its effects more prolonged than those of PROCAINE but its duration of action is shorter than that of BUPIVACAINE or PRILOCAINE.
