What is the structural formula of 5 Methyl 2 hexanol?
What is the structural formula of 5 Methyl 2 hexanol?
C7H16O
5-Methyl-2-hexanol/Formula
What is methyl hexanol used for?
Application. 2-Methyl-2-hexanol was used in the preparation of esterified phenol. It is used to study the effect of organic solvent on the equillibrium of lipase-catalyzed esterification of glycerol and decanoic acid.
What is the structure of 4 methyl 2 hexanol?
Compound with free spectra: 4 MS
| SpectraBase Compound ID | 7sgPQP55BzM |
|---|---|
| InChI | InChI=1S/C7H16O/c1-4-6(2)5-7(3)8/h6-8H,4-5H2,1-3H3 |
| InChIKey | KZUBXUKRWLMPIO-UHFFFAOYSA-N |
| Mol Weight | 116.2 g/mol |
| Molecular Formula | C7H16O |
What is the structure of 5 methyl?
5-Methylcytosine is incorporated in the nucleoside 5-methylcytidine. In 5-methylcytosine, a methyl group is attached to the 5th atom in the 6-atom ring, counting counterclockwise from the NH-bonded nitrogen at the six o’clock position. This methyl group distinguishes 5-methylcytosine from cytosine.
Is heptanol a primary alcohol?
1-heptanol is an alkyl alcohol that is heptane in which a hydrogen of one of the methyl groups is substituted by a hydroxy group. It is a primary alcohol, an alkyl alcohol and a volatile organic compound. It derives from a hydride of a heptane.
Is 3 Methyl 2 hexanol a primary alcohol?
3-Methylhexan-2-ol is a secondary alcohol.
Is 3 Methyl 2 hexanol a strong acid?
In particular, (E)-3-methyl-2-hexenoic acid (E3M2H), a C7 branched and unsaturated acid was identified as having a strong malodor.
What is the common name of hexane 2 4 Dione?
2,4-Hexanedione
| PubChem CID | 76355 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H10O2 |
| Synonyms | 2,4-Hexanedione hexane-2,4-dione 3002-24-2 Propionylacetone Acetone, propionyl- More… |
| Molecular Weight | 114.14 |
Is 3 heptanol primary secondary or tertiary?
Heptan-3-ol is a secondary alcohol.
What is the Iupac name of cytosine?
| IUPAC Name | 6-amino-1H-pyrimidin-2-one |
|---|---|
| Alternative Names | cytosine 4-Amino-2-hydroxypyrimidine 4-Amino-2(1H)-pyrimidinone 2(1H)-Pyrimidinone, 4-amino- 4-aminopyrimidin-2(1H)-one Cyt |
| Molecular Formula | C4H5N3O |
| Molar Mass | 111.104 g/mol |
| InChI | InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8) |
