What is the source of pimelic acid?
What is the source of pimelic acid?
Pimelic acid has been synthesized from cyclohexanone and from salicylic acid. In the former route, the additional carbon is supplied by dimethyloxalate, which reacts with the enolate.
What is the structural formula of pimelic acid?
C7H12O4
Pimelic acid/Formula
What is the Iupac name of pimelic acid?
heptanedioic acid
| IUPAC Name | heptanedioic acid |
|---|---|
| Alternative Names | pimelic acid Heptanedioic acid 1,5-Pentanedicarboxylic acid Heptandioic acid pimelate Heptane-1,7-dioic acid |
| Molecular Formula | C7H12O4 |
| Molar Mass | 160.169 g/mol |
| InChI | InChI=1S/C7H12O4/c8-6(9)4-2-1-3-5-7(10)11/h1-5H2,(H,8,9)(H,10,11) |
Is pimelic acid soluble in water?
Properties
| Property | Value | Source |
|---|---|---|
| Water Solubility | 13.3 mg/mL | ALOGPS |
| logP | 0.51 | ALOGPS |
| logP | 0.94 | ChemAxon |
| logS | -1.1 | ALOGPS |
What happens when pimelic acid is heated?
When adipic acid is heated,cyclopentanone is obtained . It contains one carbon atom less than Adipic acid which indicates decarboxylation,also a molecule of water is lost which results is cyclization.
Which among the following is adipic acid?
Adipic acid
| Names | |
|---|---|
| Other names Adipic acid Butane-1,4-dicarboxylic acid Hexane-1,6-dioic acid 1,4-butanedicarboxylic acid | |
| Identifiers | |
| CAS Number | 124-04-9 |
| 3D model (JSmol) | Interactive image Interactive image |
Is hexanoic acid organic?
Description : Hexanoic acid is an organic chemical compound with the chemical formula C6H12O2. The most important use of this acid is in the manufacture of its ester for artificial flavor.
Is hexanoic acid flammable?
ICSC 1167 – HEXANOIC ACID. Combustible. NO open flames. NO contact with strong oxidizing agents.
Which one of the following product is formed when Advik acid is heated?
Complete step-by-step answer: To determine the product let us see the reaction first. So, given below is the reaction of adipic acid heating, resulting in the formation of a calcium salt. In the above reaction we can see that when adipic acid is heated, the product that is formed is cyclopentanone.
What is the biosynthesis of pimelic acid?
The biosynthesis of pimelic acid is unknown but is speculated to start with malonyl CoA. Like other simple dicarboxylic acids, many methods have been developed for producing pimelic acid. Pimelic acid is produced commercially by oxidation of cycloheptanone with dinitrogen tetroxide.
How do adipic acid and pimelic acid pyrolyze?
Adipic acid (hexanedioic acid) and pimelic acid (heptanedioic acid) pyrolyze differently from the acids with a smaller number of carbon atoms. The typical reaction for these acids is the elimination of H2 O and CO 2 with the formation of a ketone by the following reaction:
Is pimelic acid a precursor to the saturated side chain?
The early recognition that pimelic acid (39) could replace biotin as an essential factor for the growth of diptheria bacillus suggested that this compound might be a precursor of the saturated side chain. Direct evidence was obtained from feeding experiments with [1,7- 14 C 2 ]pimelic acid in Aspergillus niger and Phycomyces blakesleenus cultures.
What enzymes are involved in biotin synthesis from pimeloyl CoA?
The enzymes related to biotin synthesis from pimeloyl CoA are 7-keto-8-aminopelargonic acid synthetase ( bioF gene product), 7,8-diaminopelargonic acid aminotransferase ( bioA gene product), dethiobiotin synthetase ( bioD gene product), and biotin synthetase ( bioB gene product).
