What is the formula of propanone commonly known as acetone?
What is the formula of propanone commonly known as acetone?
Acetone, or propanone, is an organic compound with the formula (CH3)2CO. It is the simplest and smallest ketone. It is a colourless, highly volatile and flammable liquid with a characteristic pungent odour.
What is the common name of 2 propanone?
acetone
acetone (CH3COCH3), also called 2-propanone or dimethyl ketone, organic solvent of industrial and chemical significance, the simplest and most important of the aliphatic (fat-derived) ketones. Pure acetone is a colourless, somewhat aromatic, flammable, mobile liquid that boils at 56.2 °C (133 °F).
What are the common uses of propanone?
Uses of propanone (acetone) The plastics industry uses about half the propanone produced. It can be converted into bisphenol A, used in the manufacture of polycarbonates and epoxy resins, used in paints and into methyl 2-methylpropenoate used to make poly(methyl 2-methylpropenoate),sold as Perspex.
Is acetone and propanone the same?
Acetone (Propanone) Acetone, a colorless liquid also known as Propanone, is a solvent used in manufacture of plastics and other industrial products.
What is the Iupac name of propanone?
| IUPAC Name | propan-2-one |
|---|---|
| Alternative Names | 2-propanone propanone Dimethyl ketone |
| Molecular Formula | C3H6O |
| Molar Mass | 58.08 g/mol |
| InChI | InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
What is the Iupac name of diethyl ketone?
pentan-3-one
| IUPAC Name | pentan-3-one |
|---|---|
| Alternative Names | 3-PENTANONE Diethyl ketone Pentan-3-one Ethyl ketone |
| Molecular Formula | C5H10O |
| Molar Mass | 86.134 g/mol |
| InChI | InChI=1S/C5H10O/c1-3-5(6)4-2/h3-4H2,1-2H3 |
How do you convert propanone to propene?
Propene, an alkene, an unsaturated organic compound, containing one double bond. Propanone is converted to 2-propanol on reduction by metal hydride in ether followed by dehydration to form propene.
Why is propanone a good solvent?
Acetone is a good solvent due to its ability to dissolve both polar and nonpolar substances, while other solvents can only dissolve one or the other. Acetone’s chemical makeup includes elements that are both polar and nonpolar which means acetone can be used with both organic and inorganic substances.
What is the molecular formula of 2-propanone?
2-Propanone, methylhydrazone PubChem CID 79840 Structure Find Similar Structures Molecular Formula C4H10N2 Synonyms 2-Propanone, methylhydrazone Acetone Molecular Weight 86.14
What is the IUPAC name of propanal?
“Propanal” is the IUPAC name of this compound; its common name is propionaldehyde. It is a saturated compound, which means there are no double bonds between carbon atoms.
What is the IUPAC name of acetone?
The IUPAC name of Acetone is 2 -propanone with a condensed chemical formula C 3 H 6 O. Acetone is made up of three carbon atoms, six hydrogen atoms, and one oxygen atom. It is considered a ketone since there is a carbonyl group present in it. A methyl ketone that consists of propane bearing an oxo group at C – 2 carbon atom.
What are the uses of propanone?
Among the uses of propanone, the major application is its use as a solvent. It is a very good solvent for many plastics and synthetic fibres. Moreover, it is useful as a chemical intermediate for the production of methyl methacrylate. Besides, this compound has been listed as a food additive.
