What is the structure of Propiophenone?
What is the structure of Propiophenone?
C9H10O
Propiophenone/Formula
How is Propiophenone prepared?
Propiophenone can be prepared by Friedel–Crafts reaction of propanoyl chloride and benzene. It is also prepared commercially by ketonization of benzoic acid and propionic acid over calcium acetate and alumina at 450–550 °C: C6H5CO2H + CH3CH2CO2H → C6H5C(O)CH2CH3 + CO2 + H2O.
What is the Iupac name of Propiophenone?
| IUPAC Name | 1-phenylpropan-1-one |
|---|---|
| Alternative Names | Propiophenone Ethyl phenyl ketone |
| Molecular Formula | C9H10O |
| Molar Mass | 134.178 g/mol |
| InChI | InChI=1S/C9H10O/c1-2-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
What is the name of C9H10O?
2-Phenylpropanal
| PubChem CID | 7146 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C9H10O |
| Synonyms | 2-Phenylpropanal 2-Phenylpropionaldehyde Hydratropaldehyde 93-53-8 Hydratropic aldehyde More… |
What is the density of Propiophenone?
1.01 g/cm³
Propiophenone/Density
What is the structure of phenyl?
Phenyl groups have six carbon atoms bonded together in a hexagonal planar ring, five of which are bonded to individual hydrogen atoms, with the remaining carbon bonded to a substituent. Phenyl groups are commonplace in organic chemistry.
Is Propiophenone water soluble?
Online Edition: “Specifications for Flavourings”
| Flavouring | Propiophenone |
|---|---|
| Solubility | insoluble in water; soluble in organic solvents, oils |
| Solubility in ethanol | miscible at room temperature |
| Boiling point (°C) | 218° |
| Assay min % | 98% |
What is the structural formula of c9h10o?
Is Propiophenone polar or nonpolar?
Propiophenone is an aromatic ketone in which the two substituents on the carbonyl C atom are phenyl and ethyl. It has a role as a fragrance….3.2.13Kovats Retention Index.
| Standard non-polar | 1164, 1140, 1144, 1148.2 |
|---|---|
| Standard polar | 1744, 1696, 1734, 1737, 1682, 1712, 1715 |
Is phenyl an EWG or EDG?
Is phenyl an EWG or EDG? – Quora. Phenyl groups are very weakly electron donating. As substituents on an aromatic ring they increase reactivity of EAS reactions and are ortgo/para directing. Comparing the acidity of formic, acetic and benzoic acids shows the ED effect.
What is the structure of phenyl chloride?
Phenyl chloride carbonate | C7H7ClO3 – PubChem.
What is phenyl structure?
What does propiophenone mean?
Propiophenone ( Phenyl ethyl ketone) is a useful intermediate to prepare nervous system drugs (anxiolytic and hypnotic drugs). B upropion is an example which has p ropiophenone moiety.
What is the difference between phenyl ethyl ketone and propiophenone?
Phenyl ketone is a fuel in the brain. Propiophenone (Phenyl ethyl ketone) is a useful intermediate to prepare nervous system drugs (anxiolytic and hypnotic drugs). Bupropion is an example which has propiophenone moiety.
What is the molecular weight of propiophenone 7148?
Propiophenone PubChem CID 7148 Synonyms Propiophenone 93-55-0 1-phenylpropan-1-o Molecular Weight 134.17 Date s Modify 2021-08-28 Create 2005-03-26
What is the basic structure of antipsychotic drugs?
Butyrophenone is the basic structure of antipsychotic drugs such as droperidol, azaperone, trifluperidol, bromperidol, and haloperidol. C hemical structure of N euroleptic agents are diverse; including phenothiazines, thioxanthenes, butyrophenones, dibenzoxazepines, dibenzodiazepines, dihydroindolones, and diphenylbutylpiperidines.
